Products 92264-82-9
CAS 92264-82-9 is the registry number for Bupropion Impurity 27. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol (CAS 92264-82-9) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol. InChIKey: NDPTTXIBLSWNSF-JOYOIKCWSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol |
| InChIKey | NDPTTXIBLSWNSF-JOYOIKCWSA-N |
| SMILES | C[C@@H]([C@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
threohydrobupropion, rac threo-Dihydro Bupropion, (1S,2S)-2-(tert-Butylamino)-1-(3-chlorophenyl)propan-1-ol, rac threo-Dihydrobupropion, Bupropion Impurity 71, S,S-threo-Hydrobupropion, Threohydrobupropion, (+-)-, THREOHYDROBUPROPION, (+/-)-, rel-(|AR)-3-Chloro-|A-[(1R)-1-[(1,1-dimethylethyl)amino]ethyl]benzenemethanol