CAS 153365-82-3 appears in our catalog under these names: Bupropion Impurity 28, Threo-dihydrobupropion. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol (CAS 153365-82-3) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol. InChIKey: NDPTTXIBLSWNSF-JOYOIKCWSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol |
| InChIKey | NDPTTXIBLSWNSF-JOYOIKCWSA-N |
| SMILES | C[C@@H]([C@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C |
Computed by PubChem (NCBI)