Products 292055-72-2
CAS 292055-72-2 is the registry number for (1R,2S)-Dihydrobupropion. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol (CAS 292055-72-2) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: (1R,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol. InChIKey: NDPTTXIBLSWNSF-CABZTGNLSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | (1R,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol |
| InChIKey | NDPTTXIBLSWNSF-CABZTGNLSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C |
Computed by PubChem (NCBI)