Products 119808-36-5

CAS 119808-36-5 is the registry number for 2-tert-Butyloxycarbonylamino-5-heptenoic Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid (CAS 119808-36-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid. InChIKey: WPKPUPUWFHDYRR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid
InChIKeyWPKPUPUWFHDYRR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCCC=C)C(=O)O

Computed by PubChem (NCBI)