CAS 204711-97-7 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)hept–6–enoic acid, Boc-Nva(Vinyl)-OH 95%, (2S)-2-[[(1,1-Dimethylethoxy)carbonyl]amino]-6-heptenoic acid, 95%, 95%, (S)-2-((tert-Butoxycarbonyl)amino)hept-6-enoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid (CAS 204711-97-7) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid. InChIKey: WPKPUPUWFHDYRR-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid |
| InChIKey | WPKPUPUWFHDYRR-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC=C)C(=O)O |
Computed by PubChem (NCBI)