Products 1198181-40-6
CAS 1198181-40-6 appears in our catalog under these names: B-[2-Cyano-3-(trifluoromethyl)phenyl]boronic acid, 98%, 98%, 2-Cyano-3-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[2-cyano-3-(trifluoromethyl)phenyl]boronic acid (CAS 1198181-40-6) is a chemical compound with the molecular formula C8H5BF3NO2 and a molecular weight of 214.94 g/mol. IUPAC name: [2-cyano-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: ISSIRNXSZUZLJV-UHFFFAOYSA-N.
| Molecular formula | C8H5BF3NO2 |
|---|---|
| Molecular weight | 214.94 g/mol |
| IUPAC name | [2-cyano-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ISSIRNXSZUZLJV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)C#N)(O)O |
Computed by PubChem (NCBI)