Products 2407353-17-5
CAS 2407353-17-5 appears in our catalog under these names: (4-Cyano-2-(trifluoromethyl)phenyl)boronic acid, 95%, 95%, (4-Cyano-2-(trifluoromethyl)phenyl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
[4-cyano-2-(trifluoromethyl)phenyl]boronic acid (CAS 2407353-17-5) is a chemical compound with the molecular formula C8H5BF3NO2 and a molecular weight of 214.94 g/mol. IUPAC name: [4-cyano-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: MIRUZDNMUCEQPN-UHFFFAOYSA-N.
| Molecular formula | C8H5BF3NO2 |
|---|---|
| Molecular weight | 214.94 g/mol |
| IUPAC name | [4-cyano-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MIRUZDNMUCEQPN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)