CAS 1218790-84-1 appears in our catalog under these names: 2-Cyano-4-(trifluoromethyl)phenylboronic acid, 95%, (2-Cyano-4-(trifluoromethyl)phenyl)boronic acid, 98%, 2-Cyano-4-(trifluoromethyl)benzeneboronic acid, 95% , 2-Cyano-4-(trifluoromethyl)phenylboronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
[2-cyano-4-(trifluoromethyl)phenyl]boronic acid (CAS 1218790-84-1) is a chemical compound with the molecular formula C8H5BF3NO2 and a molecular weight of 214.94 g/mol. IUPAC name: [2-cyano-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: DELAZGQTKSRLPA-UHFFFAOYSA-N.
| Molecular formula | C8H5BF3NO2 |
|---|---|
| Molecular weight | 214.94 g/mol |
| IUPAC name | [2-cyano-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | DELAZGQTKSRLPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)C#N)(O)O |
Computed by PubChem (NCBI)