Products 1375110-43-2
CAS 1375110-43-2 appears in our catalog under these names: 2-Cyano-5-(trifluoromethyl)phenylboronic acid, 98%, 2-Cyano-5-(trifluoromethyl)phenylboronic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
[2-cyano-5-(trifluoromethyl)phenyl]boronic acid (CAS 1375110-43-2) is a chemical compound with the molecular formula C8H5BF3NO2 and a molecular weight of 214.94 g/mol. IUPAC name: [2-cyano-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: YQGZUORHRHHHGC-UHFFFAOYSA-N.
| Molecular formula | C8H5BF3NO2 |
|---|---|
| Molecular weight | 214.94 g/mol |
| IUPAC name | [2-cyano-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YQGZUORHRHHHGC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)C#N)(O)O |
Computed by PubChem (NCBI)