CAS 1198791-54-6 appears in our catalog under these names: (R)-N-Fmoc-2-(4'-azidobutyl)alanine, N6-Diazo-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl-D-lysine, 95%, 95%. Offered by: Creative Peptides, Chemat. Available pack sizes: on request, 100mg, 250mg.
(2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid (CAS 1198791-54-6) is a chemical compound with the molecular formula C22H24N4O4 and a molecular weight of 408.4 g/mol. IUPAC name: (2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid. InChIKey: RMUCLSZPXSHUDT-JOCHJYFZSA-N.
| Molecular formula | C22H24N4O4 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhexanoic acid |
| InChIKey | RMUCLSZPXSHUDT-JOCHJYFZSA-N |
| SMILES | C[C@@](CCCCN=[N+]=[N-])(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)