Products 2978623-09-3
CAS 2978623-09-3 is the registry number for PD-L1/VISTA-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-hydroxy-2-[[6-methoxy-2-(2-methyl-3-phenylanilino)pyrimidin-4-yl]methylamino]propanoic acid (CAS 2978623-09-3) is a chemical compound with the molecular formula C22H24N4O4 and a molecular weight of 408.4 g/mol. IUPAC name: (2S)-3-hydroxy-2-[[6-methoxy-2-(2-methyl-3-phenylanilino)pyrimidin-4-yl]methylamino]propanoic acid. InChIKey: QSHNMTVUJAVARU-IBGZPJMESA-N.
| Molecular formula | C22H24N4O4 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-[[6-methoxy-2-(2-methyl-3-phenylanilino)pyrimidin-4-yl]methylamino]propanoic acid |
| InChIKey | QSHNMTVUJAVARU-IBGZPJMESA-N |
| SMILES | CC1=C(C=CC=C1NC2=NC(=CC(=N2)OC)CN[C@@H](CO)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)