Products 228999-57-3
CAS 228999-57-3 is the registry number for PI3Kα-IN-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide (CAS 228999-57-3) is a chemical compound with the molecular formula C22H24N4O4 and a molecular weight of 408.4 g/mol. IUPAC name: 4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide. InChIKey: NXKWBJJZBYCQLE-UHFFFAOYSA-N.
| Molecular formula | C22H24N4O4 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | 4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide |
| InChIKey | NXKWBJJZBYCQLE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NO1)NC(=O)NC2=CC=C(C=C2)OC3=CC=C(C=C3)C(=O)NC |
Computed by PubChem (NCBI)