Products 1263721-14-7
CAS 1263721-14-7 appears in our catalog under these names: Fmoc-L-MeLys(N3)-OH, 6-Azido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-norleucine, 95%, 95%. Offered by: Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 100 mg.
(2S)-6-azido-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hexanoic acid (CAS 1263721-14-7) is a chemical compound with the molecular formula C22H24N4O4 and a molecular weight of 408.4 g/mol. IUPAC name: (2S)-6-azido-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hexanoic acid. InChIKey: DJQVUFFDGFWHHQ-FQEVSTJZSA-N.
| Molecular formula | C22H24N4O4 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2S)-6-azido-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hexanoic acid |
| InChIKey | DJQVUFFDGFWHHQ-FQEVSTJZSA-N |
| SMILES | CN([C@@H](CCCCN=[N+]=[N-])C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)