Products 1199589-63-3

CAS 1199589-63-3 appears in our catalog under these names: 1-Aminomethyl-cyclohexanecarboxylic acid hydrochloride, 95%, 1-(Aminomethyl)cyclohexane-1-carboxylic acid hydrochloride, 1-Aminomethyl-cyclohexanecarboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

1-(aminomethyl)cyclohexane-1-carboxylic acid;hydrochloride (CAS 1199589-63-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: 1-(aminomethyl)cyclohexane-1-carboxylic acid;hydrochloride. InChIKey: MLAIBORYGCJZNW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC name1-(aminomethyl)cyclohexane-1-carboxylic acid;hydrochloride
InChIKeyMLAIBORYGCJZNW-UHFFFAOYSA-N
SMILESC1CCC(CC1)(CN)C(=O)O.Cl

Computed by PubChem (NCBI)