Products 120-95-6
CAS 120-95-6 appears in our catalog under these names: 2,4-Di-tert-pentylphenol, 95%, 2,4-Di-tert-pentylphenol, 98%, 2,4–Di–tert–amylphenol, 2,4-Di-tert-pentylphenol, 2,4-Di-tert-amylphenol, >98.0%(GC). Offered by: Fluorochem, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 100g, 500g, 5g, 5kg, 1kg, 400g, 1000g.
2,4-bis(2-methylbutan-2-yl)phenol (CAS 120-95-6) is a chemical compound with the molecular formula C16H26O and a molecular weight of 234.38 g/mol. IUPAC name: 2,4-bis(2-methylbutan-2-yl)phenol. InChIKey: WMVJWKURWRGJCI-UHFFFAOYSA-N.
| Molecular formula | C16H26O |
|---|---|
| Molecular weight | 234.38 g/mol |
| IUPAC name | 2,4-bis(2-methylbutan-2-yl)phenol |
| InChIKey | WMVJWKURWRGJCI-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1)O)C(C)(C)CC |
Computed by PubChem (NCBI)
Synonyms:
2,4-Di-tert-pentylphenol, 2,4-Di-tert-amylphenol, Phenol, 2,4-bis(1,1-dimethylpropyl)-, 2,4-Bis(1,1-dimethylpropyl)phenol, 2,4-bis(2-methylbutan-2-yl)phenol, 2,4-di(1,1-dimethylpropyl)phenol, 2,4-di-tert-amyl phenol, 2,4-di-tert-Pentylphenyl, WMVJWKURWRGJCI-UHFFFAOYSA-, 3-06-00-02085 (Beilstein Handbook Reference)