CAS 1369809-13-1 is the registry number for 2-(tert-Butoxy)-1,3-diisopropylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-methylpropan-2-yl)oxy]-1,3-di(propan-2-yl)benzene (CAS 1369809-13-1) is a chemical compound with the molecular formula C16H26O and a molecular weight of 234.38 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxy]-1,3-di(propan-2-yl)benzene. InChIKey: DIJATWAUVFZRSG-UHFFFAOYSA-N.
| Molecular formula | C16H26O |
|---|---|
| Molecular weight | 234.38 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxy]-1,3-di(propan-2-yl)benzene |
| InChIKey | DIJATWAUVFZRSG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)