CAS 57354-65-1 is the registry number for 4-(tert-Butyl)-2,6-diisopropylphenol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-tert-butyl-2,6-di(propan-2-yl)phenol (CAS 57354-65-1) is a chemical compound with the molecular formula C16H26O and a molecular weight of 234.38 g/mol. IUPAC name: 4-tert-butyl-2,6-di(propan-2-yl)phenol. InChIKey: JERVKJDPAKUDRH-UHFFFAOYSA-N.
| Molecular formula | C16H26O |
|---|---|
| Molecular weight | 234.38 g/mol |
| IUPAC name | 4-tert-butyl-2,6-di(propan-2-yl)phenol |
| InChIKey | JERVKJDPAKUDRH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C(C)(C)C |
Computed by PubChem (NCBI)