CAS 858859-67-3 is the registry number for 2–(3,5–Di–tert–butylphenyl)ethanol. Offered by: GLPBio. Available pack sizes: 25mg.
2-(3,5-ditert-butylphenyl)ethanol (CAS 858859-67-3) is a chemical compound with the molecular formula C16H26O and a molecular weight of 234.38 g/mol. IUPAC name: 2-(3,5-ditert-butylphenyl)ethanol. InChIKey: BHZUDPUPBDUULY-UHFFFAOYSA-N.
| Molecular formula | C16H26O |
|---|---|
| Molecular weight | 234.38 g/mol |
| IUPAC name | 2-(3,5-ditert-butylphenyl)ethanol |
| InChIKey | BHZUDPUPBDUULY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)CCO)C(C)(C)C |
Computed by PubChem (NCBI)