CAS 1200-88-0 appears in our catalog under these names: 5-Norbornene-2-endo,3-exo-dicarboxylic acid, 95%, 5-NORBORNENE-2-ENDO,3-EXO-DICARBOXYLIC &, 5-norbornene-2-endo，3-exo-dicarboxylic acid, 98%, 98%, endo-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 98%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
(1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (CAS 1200-88-0) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid. InChIKey: NIDNOXCRFUCAKQ-XZBKPIIZSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| InChIKey | NIDNOXCRFUCAKQ-XZBKPIIZSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]([C@@H]2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)