CAS 3853-88-1 appears in our catalog under these names: cis–5–Norbornene–endo–2,3–dicarboxylic acid, cis-5-Norbornene-endo-2,3-dicarboxylic acid, 98% , cis-5-Norbornene-endo-2,3-dicarboxylic Acid, >98.0%(GC)(T), cis-endo-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid 97%, cis-endo-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 25g, 5g, 10g.
(1R,2S,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (CAS 3853-88-1) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: (1R,2S,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid. InChIKey: NIDNOXCRFUCAKQ-UMRXKNAASA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (1R,2S,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| InChIKey | NIDNOXCRFUCAKQ-UMRXKNAASA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]([C@H]2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)