CAS 196941-79-4 is the registry number for (1R,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (CAS 196941-79-4) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: (1S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid. InChIKey: NIDNOXCRFUCAKQ-DPTVFECHSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (1S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| InChIKey | NIDNOXCRFUCAKQ-DPTVFECHSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1C(C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)