CAS 3813-52-3 appears in our catalog under these names: Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 98%, 5–Norbornene–2,3–dicarboxylic Acid, 5-Norbornene-2,3-dicarboxylic Acid, >97.0%(GC), cis-endo-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid 98% (cis-endo-), CIS-5-NORBORNENE-ENDO-2,3-DICARBOXYLIC &. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 500g, 100g, 1000g, 1kg.
Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (CAS 3813-52-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid. InChIKey: NIDNOXCRFUCAKQ-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| InChIKey | NIDNOXCRFUCAKQ-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C(C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)