CAS 120003-75-0 appears in our catalog under these names: 2-Chloro-5,6-dimethylnicotinic acid, 95%, 2-Chloro-5,6-dimethyl Nicotinic Acid, 2–Chloro–5,6–dimethylnicotinic acid. Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 250mg, 5g, 1g, 500mg, 100mg.
2-chloro-5,6-dimethylpyridine-3-carboxylic acid (CAS 120003-75-0) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-5,6-dimethylpyridine-3-carboxylic acid. InChIKey: JGTHNXDWSRAIAT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-5,6-dimethylpyridine-3-carboxylic acid |
| InChIKey | JGTHNXDWSRAIAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1C)Cl)C(=O)O |
Computed by PubChem (NCBI)