CAS 120042-11-7 appears in our catalog under these names: N-Boc-L-homoserine methyl ester, 96%, Boc-Hse-OMe, 95%, (S)–Methyl 2–((tert–butoxycarbonyl)amino)–4–hydroxybutanoate, N-Boc-L-Homoserine Methyl Ester, >95%, >95%, (S)-Methyl 2-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g.
Methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 120042-11-7) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: IWNVPOPPBRMFNG-ZETCQYMHSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | IWNVPOPPBRMFNG-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)C(=O)OC |
Computed by PubChem (NCBI)