CAS 188476-33-7 appears in our catalog under these names: N-Boc-alpha-methyl-d-serine methyl ester, 95%, N-Boc-2-methyl-D-serine methyl ester, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg.
Methyl (2R)-3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 188476-33-7) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: methyl (2R)-3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: OUUNEDPIBZNRMT-SNVBAGLBSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl (2R)-3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | OUUNEDPIBZNRMT-SNVBAGLBSA-N |
| SMILES | C[C@@](CO)(C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)