CAS 96099-84-2 appears in our catalog under these names: Boc-D-Thr-OMe, 96%, N–(tert–Butoxycarbonyl)–D–threonine Methyl Ester, N-(tert-Butoxycarbonyl)-D-threonine Methyl Ester, >98.0%(HPLC)(N), (2R,3S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-hydroxybutanoate, 98%, 98%, N-(tert-Butoxycarbonyl)-D-threonine Methyl Ester, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Methyl (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 96099-84-2) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: methyl (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: MZMWAPNVRMDIPS-NKWVEPMBSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | MZMWAPNVRMDIPS-NKWVEPMBSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)