CAS 122902-81-2 appears in our catalog under these names: Boc-n-me-ser-ome, 95%, Boc-N-Me-Ser-OMe, Methyl N-(tert-butoxycarbonyl)-N-methyl-L-serinate, 96%, 96%, Boc-N-Me-Ser-OMe, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 2g, 5g.
Methyl (2S)-3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (CAS 122902-81-2) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate. InChIKey: LUHJSLLCWQRODJ-ZETCQYMHSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| InChIKey | LUHJSLLCWQRODJ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CO)C(=O)OC |
Computed by PubChem (NCBI)