CAS 120095-52-5 appears in our catalog under these names: 2-Amino-3-(4-methyl-1h-pyrazol-1-yl)propanoic acid hydrochloride, 95%, 2-Amino-3-(4-methyl-1H-pyrazol-1-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-amino-3-(4-methylpyrazol-1-yl)propanoic acid;hydrochloride (CAS 120095-52-5) is a chemical compound with the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. IUPAC name: 2-amino-3-(4-methylpyrazol-1-yl)propanoic acid;hydrochloride. InChIKey: YGUYCUDFDGECEM-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN3O2 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 2-amino-3-(4-methylpyrazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | YGUYCUDFDGECEM-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)