Products 28937-09-9
CAS 28937-09-9 is the registry number for 1,3,7-Triazaspiro[4.5]decane-2,4-dione hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,3,9-triazaspiro[4.5]decane-2,4-dione;hydrochloride (CAS 28937-09-9) is a chemical compound with the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. IUPAC name: 1,3,9-triazaspiro[4.5]decane-2,4-dione;hydrochloride. InChIKey: VJAWKWYPFADZEI-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN3O2 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 1,3,9-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| InChIKey | VJAWKWYPFADZEI-UHFFFAOYSA-N |
| SMILES | C1CC2(CNC1)C(=O)NC(=O)N2.Cl |
Computed by PubChem (NCBI)