CAS 17451-62-6 appears in our catalog under these names: N-Alpha-methyl-l-histidine hydrochloride, 95%, N-Methyl-L-histidine Hydrochloride, N–Me–His–OH · HCl, N-Me-His-OH HCl 95%, N-Alpha-methyl-l-histidine HCl, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg.
(2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoic acid;hydrochloride (CAS 17451-62-6) is a chemical compound with the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. IUPAC name: (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoic acid;hydrochloride. InChIKey: QQCAMJPAJDEDCG-RGMNGODLSA-N.
| Molecular formula | C7H12ClN3O2 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoic acid;hydrochloride |
| InChIKey | QQCAMJPAJDEDCG-RGMNGODLSA-N |
| SMILES | CN[C@@H](CC1=CN=CN1)C(=O)O.Cl |
Computed by PubChem (NCBI)