CAS 1796890-20-4 appears in our catalog under these names: Methyl 2-amino-2-(1-methyl-1h-pyrazol-3-yl)acetate hydrochloride, 95%, Methyl 2–amino–2–(1–methyl–1H–pyrazol–3–yl)acetate hydrochloride, Methyl 2-amino-2-(1-methyl-1H-pyrazol-3-yl)acetate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 50mg, 0,5g.
Methyl 2-amino-2-(1-methylpyrazol-3-yl)acetate;hydrochloride (CAS 1796890-20-4) is a chemical compound with the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. IUPAC name: methyl 2-amino-2-(1-methylpyrazol-3-yl)acetate;hydrochloride. InChIKey: WJMISEPYYOBQOD-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN3O2 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | methyl 2-amino-2-(1-methylpyrazol-3-yl)acetate;hydrochloride |
| InChIKey | WJMISEPYYOBQOD-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)C(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)