CAS 1201633-84-2 appears in our catalog under these names: 2-(3-Bromo-4-methylphenyl)acetic acid, 95%, (3-Bromo-4-methylphenyl)acetic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg.
2-(3-bromo-4-methylphenyl)acetic acid (CAS 1201633-84-2) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(3-bromo-4-methylphenyl)acetic acid. InChIKey: POUORGSHKJVFIC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(3-bromo-4-methylphenyl)acetic acid |
| InChIKey | POUORGSHKJVFIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(=O)O)Br |
Computed by PubChem (NCBI)