Products 120181-15-9
CAS 120181-15-9 is the registry number for 1-(2,5-dichlorophenyl)-3-methyl-1H-pyrazol-5-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2,5-dichlorophenyl)-5-methylpyrazol-3-amine (CAS 120181-15-9) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-5-methylpyrazol-3-amine. InChIKey: HATZSNUDRWZFKO-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-5-methylpyrazol-3-amine |
| InChIKey | HATZSNUDRWZFKO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)