Products 1201832-32-7
CAS 1201832-32-7 is the registry number for HYDAMTIQ. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(dimethylamino)methyl]-9-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one (CAS 1201832-32-7) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: 2-[(dimethylamino)methyl]-9-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one. InChIKey: NNRFUSBXQVBAEO-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2S |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | 2-[(dimethylamino)methyl]-9-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one |
| InChIKey | NNRFUSBXQVBAEO-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC2=C(S1)NC(=O)C3=C2C(=CC=C3)O |
Computed by PubChem (NCBI)