Products 1201905-64-7
CAS 1201905-64-7 is the registry number for 1-((R)-(methylamino)(phenyl)methyl)naphthalen-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(R)-methylamino(phenyl)methyl]naphthalen-2-ol (CAS 1201905-64-7) is a chemical compound with the molecular formula C18H17NO and a molecular weight of 263.3 g/mol. IUPAC name: 1-[(R)-methylamino(phenyl)methyl]naphthalen-2-ol. InChIKey: ZVQHRWAHFINXHH-GOSISDBHSA-N.
| Molecular formula | C18H17NO |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 1-[(R)-methylamino(phenyl)methyl]naphthalen-2-ol |
| InChIKey | ZVQHRWAHFINXHH-GOSISDBHSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1)C2=C(C=CC3=CC=CC=C32)O |
Computed by PubChem (NCBI)