CAS 592550-44-2 is the registry number for 2-Methyl-1-((4-methylphenyl)methyl)-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-methyl-1-[(4-methylphenyl)methyl]indole-3-carbaldehyde (CAS 592550-44-2) is a chemical compound with the molecular formula C18H17NO and a molecular weight of 263.3 g/mol. IUPAC name: 2-methyl-1-[(4-methylphenyl)methyl]indole-3-carbaldehyde. InChIKey: UEBAIQJONCIGCA-UHFFFAOYSA-N.
| Molecular formula | C18H17NO |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 2-methyl-1-[(4-methylphenyl)methyl]indole-3-carbaldehyde |
| InChIKey | UEBAIQJONCIGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=C(C3=CC=CC=C32)C=O)C |
Computed by PubChem (NCBI)