CAS 1228552-95-1 is the registry number for 1-Benzyl-2,5-dimethyl-1h-indole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-benzyl-2,5-dimethylindole-3-carbaldehyde (CAS 1228552-95-1) is a chemical compound with the molecular formula C18H17NO and a molecular weight of 263.3 g/mol. IUPAC name: 1-benzyl-2,5-dimethylindole-3-carbaldehyde. InChIKey: UJTFYHRAABPCDZ-UHFFFAOYSA-N.
| Molecular formula | C18H17NO |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 1-benzyl-2,5-dimethylindole-3-carbaldehyde |
| InChIKey | UJTFYHRAABPCDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=C2C=O)C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)