CAS 150300-53-1 is the registry number for 2-(2,2-dimethylpropanoyl)-3-(2-naphthyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(2E)-4,4-dimethyl-2-(naphthalen-2-ylmethylidene)-3-oxopentanenitrile (CAS 150300-53-1) is a chemical compound with the molecular formula C18H17NO and a molecular weight of 263.3 g/mol. IUPAC name: (2E)-4,4-dimethyl-2-(naphthalen-2-ylmethylidene)-3-oxopentanenitrile. InChIKey: HLRMXBGWZWJHCR-LFIBNONCSA-N.
| Molecular formula | C18H17NO |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | (2E)-4,4-dimethyl-2-(naphthalen-2-ylmethylidene)-3-oxopentanenitrile |
| InChIKey | HLRMXBGWZWJHCR-LFIBNONCSA-N |
| SMILES | CC(C)(C)C(=O)/C(=C/C1=CC2=CC=CC=C2C=C1)/C#N |
Computed by PubChem (NCBI)