CAS 561052-59-3 is the registry number for 1-(Amino-p-tolyl-methyl)-naphthalen-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
1-[amino-(4-methylphenyl)methyl]naphthalen-2-ol (CAS 561052-59-3) is a chemical compound with the molecular formula C18H17NO and a molecular weight of 263.3 g/mol. IUPAC name: 1-[amino-(4-methylphenyl)methyl]naphthalen-2-ol. InChIKey: WOXKSBPHXSAUAJ-UHFFFAOYSA-N.
| Molecular formula | C18H17NO |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 1-[amino-(4-methylphenyl)methyl]naphthalen-2-ol |
| InChIKey | WOXKSBPHXSAUAJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=C(C=CC3=CC=CC=C32)O)N |
Computed by PubChem (NCBI)