Products 1202063-44-2
CAS 1202063-44-2 is the registry number for D-Aspartic-2,3,3-d3 Acid. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(2R)-2-amino-2,3,3-trideuteriobutanedioic acid (CAS 1202063-44-2) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 136.12 g/mol. IUPAC name: (2R)-2-amino-2,3,3-trideuteriobutanedioic acid. InChIKey: CKLJMWTZIZZHCS-MIRRBZTDSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 136.12 g/mol |
| IUPAC name | (2R)-2-amino-2,3,3-trideuteriobutanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-MIRRBZTDSA-N |
| SMILES | [2H][C@](C(=O)O)(C([2H])([2H])C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
D-Aspartic-2,3,3-d3 Acid, D-Aspartic-2,3,3-d3Acid