Products 1202063-56-6
CAS 1202063-56-6 is the registry number for D-Glutamic acid-13C5,15N. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid (CAS 1202063-56-6) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 153.09 g/mol. IUPAC name: (2R)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-IGIFWJAOSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 153.09 g/mol |
| IUPAC name | (2R)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-IGIFWJAOSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13C@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)