CAS 120209-97-4 appears in our catalog under these names: 2,7-Diaminophenazine, Phenazine-2,7-diamine 95%. Offered by: TRC, Ambeed. Available pack sizes: 250mg, 50mg, 100mg, 1g.
Phenazine-2,7-diamine (CAS 120209-97-4) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: phenazine-2,7-diamine. InChIKey: ZNXLTODDKYXLAD-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | phenazine-2,7-diamine |
| InChIKey | ZNXLTODDKYXLAD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=C3C=CC(=CC3=N2)N |
Computed by PubChem (NCBI)