CAS 120279-89-2 appears in our catalog under these names: Dorzolamide Impurity 37 (rac-Dorzolamide), Dorzolamide Impurity 19. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 200mg, 25mg, 50mg.
(4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (CAS 120279-89-2) is a chemical compound with the molecular formula C10H16N2O4S3 and a molecular weight of 324.4 g/mol. IUPAC name: (4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide. InChIKey: IAVUPMFITXYVAF-HTRCEHHLSA-N.
| Molecular formula | C10H16N2O4S3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| InChIKey | IAVUPMFITXYVAF-HTRCEHHLSA-N |
| SMILES | CCN[C@@H]1C[C@H](S(=O)(=O)C2=C1C=C(S2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)