Products 199734-71-9
CAS 199734-71-9 appears in our catalog under these names: Dorzolamide Impurity 18, 2-Desaminosulfonyl 3-Aminosulfonyl Dorzolamide, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-3-sulfonamide (CAS 199734-71-9) is a chemical compound with the molecular formula C10H16N2O4S3 and a molecular weight of 324.4 g/mol. IUPAC name: (4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-3-sulfonamide. InChIKey: OYKFJBJRSHWGIS-BQBZGAKWSA-N.
| Molecular formula | C10H16N2O4S3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-3-sulfonamide |
| InChIKey | OYKFJBJRSHWGIS-BQBZGAKWSA-N |
| SMILES | CCN[C@H]1C[C@@H](S(=O)(=O)C2=C1C(=CS2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)