CAS 1203-43-6 is the registry number for 2'-Chloro-[1,1'-biphenyl]-2-amine, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-chlorophenyl)aniline (CAS 1203-43-6) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 2-(2-chlorophenyl)aniline. InChIKey: JLXPLVOQXSESCC-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-(2-chlorophenyl)aniline |
| InChIKey | JLXPLVOQXSESCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)