Products 120330-90-7
CAS 120330-90-7 is the registry number for Jasmonoyl-valine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]butanoic acid (CAS 120330-90-7) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: (2S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]butanoic acid. InChIKey: LZPFFKBGBPBJAW-JSIGFUFCSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]butanoic acid |
| InChIKey | LZPFFKBGBPBJAW-JSIGFUFCSA-N |
| SMILES | CC/C=C\C[C@@H]1[C@H](CCC1=O)CC(=O)N[C@@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
N-[(3R,7R)-(?)-Jasmonoyl]-(S)-valine, orb3173133