CAS 1203499-39-1 is the registry number for N-(2-Cyanofuro[3,2-b]pyridin-7-yl)pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2-cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide (CAS 1203499-39-1) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: N-(2-cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide. InChIKey: IHPVDBFKYPBQHI-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | N-(2-cyanofuro[3,2-b]pyridin-7-yl)-2,2-dimethylpropanamide |
| InChIKey | IHPVDBFKYPBQHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C2C(=NC=C1)C=C(O2)C#N |
Computed by PubChem (NCBI)