Products 1203499-56-2
CAS 1203499-56-2 is the registry number for 2-(Dimethoxymethyl)-6-methyl-1,8-naphthyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(dimethoxymethyl)-6-methyl-1,8-naphthyridine (CAS 1203499-56-2) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-(dimethoxymethyl)-6-methyl-1,8-naphthyridine. InChIKey: HKLITSAOGZOQKJ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-(dimethoxymethyl)-6-methyl-1,8-naphthyridine |
| InChIKey | HKLITSAOGZOQKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1)N=C(C=C2)C(OC)OC |
Computed by PubChem (NCBI)