CAS 1203610-94-9 is the registry number for Ethyl 5-(3-hydroxyphenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(3-hydroxyphenyl)-1,2-oxazole-3-carboxylate (CAS 1203610-94-9) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: ethyl 5-(3-hydroxyphenyl)-1,2-oxazole-3-carboxylate. InChIKey: BJTUFTHPXQPNRJ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | ethyl 5-(3-hydroxyphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | BJTUFTHPXQPNRJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)