CAS 1203684-66-5 appears in our catalog under these names: 7-Bromo-4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97%, 97%, 7-Bromo-4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg, 5g.
7-bromo-4,4-dimethyl-2,3-dihydro-1H-isoquinoline;hydrochloride (CAS 1203684-66-5) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 7-bromo-4,4-dimethyl-2,3-dihydro-1H-isoquinoline;hydrochloride. InChIKey: YTOUGVCISANLIE-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 7-bromo-4,4-dimethyl-2,3-dihydro-1H-isoquinoline;hydrochloride |
| InChIKey | YTOUGVCISANLIE-UHFFFAOYSA-N |
| SMILES | CC1(CNCC2=C1C=CC(=C2)Br)C.Cl |
Computed by PubChem (NCBI)